C18H24N4O2 — CID 168952712
5-amino-2-(2-methoxyethylamino)-N-(pyridin-3-ylmethyl)benzamide;ethene (PubChem CID 168952712) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is 5-amino-2-(2-methoxyethylamino)-N-(pyridin-3-ylmethyl)benzamide;ethene.
| Compound Name | 5-amino-2-(2-methoxyethylamino)-N-(pyridin-3-ylmethyl)benzamide;ethene |
|---|---|
| PubChem CID | 168952712 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 5-amino-2-(2-methoxyethylamino)-N-(pyridin-3-ylmethyl)benzamide;ethene |
| SMILES | C=C.COCCNc1ccc(N)cc1C(=O)NCc1cccnc1 |
| InChI | InChI=1S/C16H20N4O2.C2H4/c1-22-8-7-19-15-5-4-13(17)9-14(15)16(21)20-11-12-3-2-6-18-10-12;1-2/h2-6,9-10,19H,7-8,11,17H2,1H3,(H,20,21);1-2H2 |
| InChIKey | GIDACPLKKXUMRB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|