C21H20N8O2 — CID 168953496
5-[[5-[6-[[(1R,2S,4S,5S)-4-amino-2-bicyclo[3.1.0]hexanyl]oxy]-2,3-dihydrofuro[3,2-b]pyridin-7-yl]-1H-pyrazol-3-yl]amino]pyrazine-2-carbonitrile (PubChem CID 168953496) has the molecular formula C21H20N8O2 and a molecular weight of 416.45 g/mol. Its IUPAC name is 5-[[5-[6-[[(1R,2S,4S,5S)-4-amino-2-bicyclo[3.1.0]hexanyl]oxy]-2,3-dihydrofuro[3,2-b]pyridin-7-yl]-1H-pyrazol-3-yl]amino]pyrazine-2-carbonitrile.
| Compound Name | 5-[[5-[6-[[(1R,2S,4S,5S)-4-amino-2-bicyclo[3.1.0]hexanyl]oxy]-2,3-dihydrofuro[3,2-b]pyridin-7-yl]-1H-pyrazol-3-yl]amino]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 168953496 |
| Molecular Formula | C21H20N8O2 |
| Molecular Weight | 416.45 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 5-[[5-[6-[[(1R,2S,4S,5S)-4-amino-2-bicyclo[3.1.0]hexanyl]oxy]-2,3-dihydrofuro[3,2-b]pyridin-7-yl]-1H-pyrazol-3-yl]amino]pyrazine-2-carbonitrile |
| SMILES | N#Cc1cnc(Nc2cc(-c3c(O[C@H]4C[C@H](N)[C@H]5C[C@H]54)cnc4c3OCC4)[nH]n2)cn1 |
| InChI | InChI=1S/C21H20N8O2/c22-6-10-7-26-19(9-24-10)27-18-5-15(28-29-18)20-17(8-25-14-1-2-30-21(14)20)31-16-4-13(23)11-3-12(11)16/h5,7-9,11-13,16H,1-4,23H2,(H2,26,27,28,29)/t11-,12+,13-,16-/m0/s1 |
| InChIKey | ZKFZVIVTDJZNCZ-ZWUHOBOKSA-N |
| XLogP | 1.93 |
| TPSA | 147.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.45 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |