C15H27N3O4S — CID 168954107
tert-butyl 4-(3-azabicyclo[3.1.0]hexan-1-ylmethylsulfonyl)piperazine-1-carboxylate (PubChem CID 168954107) has the molecular formula C15H27N3O4S and a molecular weight of 345.47 g/mol. Its IUPAC name is tert-butyl 4-(3-azabicyclo[3.1.0]hexan-1-ylmethylsulfonyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(3-azabicyclo[3.1.0]hexan-1-ylmethylsulfonyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 168954107 |
| Molecular Formula | C15H27N3O4S |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | tert-butyl 4-(3-azabicyclo[3.1.0]hexan-1-ylmethylsulfonyl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(S(=O)(=O)CC23CNCC2C3)CC1 |
| InChI | InChI=1S/C15H27N3O4S/c1-14(2,3)22-13(19)17-4-6-18(7-5-17)23(20,21)11-15-8-12(15)9-16-10-15/h12,16H,4-11H2,1-3H3 |
| InChIKey | BQUIRUVXUVSLAS-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |