C14H28N2O6S — CID 110605694
tert-butyl 4-[2-(2-methoxyethoxy)ethylsulfonyl]piperazine-1-carboxylate (PubChem CID 110605694) has the molecular formula C14H28N2O6S and a molecular weight of 352.45 g/mol. Its IUPAC name is tert-butyl 4-[2-(2-methoxyethoxy)ethylsulfonyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(2-methoxyethoxy)ethylsulfonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 110605694 |
| Molecular Formula | C14H28N2O6S |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | tert-butyl 4-[2-(2-methoxyethoxy)ethylsulfonyl]piperazine-1-carboxylate |
| SMILES | COCCOCCS(=O)(=O)N1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C14H28N2O6S/c1-14(2,3)22-13(17)15-5-7-16(8-6-15)23(18,19)12-11-21-10-9-20-4/h5-12H2,1-4H3 |
| InChIKey | IUSZDYFAPZFLNH-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|