C9H19N3O5S — CID 113235213
4-[2-(2-methoxyethoxy)acetyl]piperazine-1-sulfonamide (PubChem CID 113235213) has the molecular formula C9H19N3O5S and a molecular weight of 281.33 g/mol. Its IUPAC name is 4-[2-(2-methoxyethoxy)acetyl]piperazine-1-sulfonamide.
| Compound Name | 4-[2-(2-methoxyethoxy)acetyl]piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 113235213 |
| Molecular Formula | C9H19N3O5S |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 4-[2-(2-methoxyethoxy)acetyl]piperazine-1-sulfonamide |
| SMILES | COCCOCC(=O)N1CCN(S(N)(=O)=O)CC1 |
| InChI | InChI=1S/C9H19N3O5S/c1-16-6-7-17-8-9(13)11-2-4-12(5-3-11)18(10,14)15/h2-8H2,1H3,(H2,10,14,15) |
| InChIKey | DHHKRRUOFHCICT-UHFFFAOYSA-N |
| XLogP | -2.00 |
| TPSA | 102.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|