C12H19F3N2O4 — CID 108543737
2,2,2-trifluoro-1-[4-[2-(2-methoxyethoxy)acetyl]-1,4-diazepan-1-yl]ethanone (PubChem CID 108543737) has the molecular formula C12H19F3N2O4 and a molecular weight of 312.29 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[4-[2-(2-methoxyethoxy)acetyl]-1,4-diazepan-1-yl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[4-[2-(2-methoxyethoxy)acetyl]-1,4-diazepan-1-yl]ethanone |
|---|---|
| PubChem CID | 108543737 |
| Molecular Formula | C12H19F3N2O4 |
| Molecular Weight | 312.29 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 2,2,2-trifluoro-1-[4-[2-(2-methoxyethoxy)acetyl]-1,4-diazepan-1-yl]ethanone |
| SMILES | COCCOCC(=O)N1CCCN(C(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H19F3N2O4/c1-20-7-8-21-9-10(18)16-3-2-4-17(6-5-16)11(19)12(13,14)15/h2-9H2,1H3 |
| InChIKey | SYYRAHVPJPNSTJ-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.29 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|