C12H23N3O4 — CID 108570063
4-[2-(2-methoxyethoxy)acetyl]-N,N-dimethylpiperazine-1-carboxamide (PubChem CID 108570063) has the molecular formula C12H23N3O4 and a molecular weight of 273.33 g/mol. Its IUPAC name is 4-[2-(2-methoxyethoxy)acetyl]-N,N-dimethylpiperazine-1-carboxamide.
| Compound Name | 4-[2-(2-methoxyethoxy)acetyl]-N,N-dimethylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 108570063 |
| Molecular Formula | C12H23N3O4 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 4-[2-(2-methoxyethoxy)acetyl]-N,N-dimethylpiperazine-1-carboxamide |
| SMILES | COCCOCC(=O)N1CCN(C(=O)N(C)C)CC1 |
| InChI | InChI=1S/C12H23N3O4/c1-13(2)12(17)15-6-4-14(5-7-15)11(16)10-19-9-8-18-3/h4-10H2,1-3H3 |
| InChIKey | SCXOHYMTIHDYGK-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|