C22H19BrF2N3O4PS — CID 168955366
[[3-bromo-5-formyl-7-[(4-pyrimidin-2-ylphenyl)methoxy]-1-benzothiophen-2-yl]-difluoromethyl]phosphonous acid;methanamine (PubChem CID 168955366) has the molecular formula C22H19BrF2N3O4PS and a molecular weight of 570.35 g/mol. Its IUPAC name is [[3-bromo-5-formyl-7-[(4-pyrimidin-2-ylphenyl)methoxy]-1-benzothiophen-2-yl]-difluoromethyl]phosphonous acid;methanamine.
| Compound Name | [[3-bromo-5-formyl-7-[(4-pyrimidin-2-ylphenyl)methoxy]-1-benzothiophen-2-yl]-difluoromethyl]phosphonous acid;methanamine |
|---|---|
| PubChem CID | 168955366 |
| Molecular Formula | C22H19BrF2N3O4PS |
| Molecular Weight | 570.35 g/mol |
| Exact Mass | 569.00 |
| IUPAC Name | [[3-bromo-5-formyl-7-[(4-pyrimidin-2-ylphenyl)methoxy]-1-benzothiophen-2-yl]-difluoromethyl]phosphonous acid;methanamine |
| SMILES | CN.O=Cc1cc(OCc2ccc(-c3ncccn3)cc2)c2sc(C(F)(F)P(O)O)c(Br)c2c1 |
| InChI | InChI=1S/C21H14BrF2N2O4PS.CH5N/c22-17-15-8-13(10-27)9-16(18(15)32-19(17)21(23,24)31(28)29)30-11-12-2-4-14(5-3-12)20-25-6-1-7-26-20;1-2/h1-10,28-29H,11H2;2H2,1H3 |
| InChIKey | VAVPKDCXSYCCFA-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 118.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.35 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|