C24H27FN4OS — CID 168956842
N-[1-[6-(5-cyano-3-pyridinyl)-1-(2,2-dimethylpropyl)-5-fluoroindol-3-yl]ethyl]cyclopropanesulfinamide (PubChem CID 168956842) has the molecular formula C24H27FN4OS and a molecular weight of 438.57 g/mol. Its IUPAC name is N-[1-[6-(5-cyano-3-pyridinyl)-1-(2,2-dimethylpropyl)-5-fluoroindol-3-yl]ethyl]cyclopropanesulfinamide.
| Compound Name | N-[1-[6-(5-cyano-3-pyridinyl)-1-(2,2-dimethylpropyl)-5-fluoroindol-3-yl]ethyl]cyclopropanesulfinamide |
|---|---|
| PubChem CID | 168956842 |
| Molecular Formula | C24H27FN4OS |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | N-[1-[6-(5-cyano-3-pyridinyl)-1-(2,2-dimethylpropyl)-5-fluoroindol-3-yl]ethyl]cyclopropanesulfinamide |
| SMILES | CC(NS(=O)C1CC1)c1cn(CC(C)(C)C)c2cc(-c3cncc(C#N)c3)c(F)cc12 |
| InChI | InChI=1S/C24H27FN4OS/c1-15(28-31(30)18-5-6-18)21-13-29(14-24(2,3)4)23-9-19(22(25)8-20(21)23)17-7-16(10-26)11-27-12-17/h7-9,11-13,15,18,28H,5-6,14H2,1-4H3 |
| InChIKey | IWAFYXQLEONVHJ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|