C22H47N3O2 — CID 168958672
N-[3-(ethylamino)propyl]-9-(3-methylbutanoylamino)nonanamide;propane (PubChem CID 168958672) has the molecular formula C22H47N3O2 and a molecular weight of 385.64 g/mol. Its IUPAC name is N-[3-(ethylamino)propyl]-9-(3-methylbutanoylamino)nonanamide;propane.
| Compound Name | N-[3-(ethylamino)propyl]-9-(3-methylbutanoylamino)nonanamide;propane |
|---|---|
| PubChem CID | 168958672 |
| Molecular Formula | C22H47N3O2 |
| Molecular Weight | 385.64 g/mol |
| Exact Mass | 385.37 |
| IUPAC Name | N-[3-(ethylamino)propyl]-9-(3-methylbutanoylamino)nonanamide;propane |
| SMILES | CCC.CCNCCCNC(=O)CCCCCCCCNC(=O)CC(C)C |
| InChI | InChI=1S/C19H39N3O2.C3H8/c1-4-20-13-11-15-21-18(23)12-9-7-5-6-8-10-14-22-19(24)16-17(2)3;1-3-2/h17,20H,4-16H2,1-3H3,(H,21,23)(H,22,24);3H2,1-2H3 |
| InChIKey | WCFBCPFSWRFDOA-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.64 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|