C19H41NO — CID 170638874
ethane;3-methyl-N-nonylbutanamide;prop-1-ene (PubChem CID 170638874) has the molecular formula C19H41NO and a molecular weight of 299.54 g/mol. Its IUPAC name is ethane;3-methyl-N-nonylbutanamide;prop-1-ene.
| Compound Name | ethane;3-methyl-N-nonylbutanamide;prop-1-ene |
|---|---|
| PubChem CID | 170638874 |
| Molecular Formula | C19H41NO |
| Molecular Weight | 299.54 g/mol |
| Exact Mass | 299.32 |
| IUPAC Name | ethane;3-methyl-N-nonylbutanamide;prop-1-ene |
| SMILES | C=CC.CC.CCCCCCCCCNC(=O)CC(C)C |
| InChI | InChI=1S/C14H29NO.C3H6.C2H6/c1-4-5-6-7-8-9-10-11-15-14(16)12-13(2)3;1-3-2;1-2/h13H,4-12H2,1-3H3,(H,15,16);3H,1H2,2H3;1-2H3 |
| InChIKey | LRRASHXXQJVXJT-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.54 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|