C20H47N3O — CID 168958962
ethane;N'-ethyl-N-methylpropane-1,3-diamine;9-(propan-2-ylamino)nonanal (PubChem CID 168958962) has the molecular formula C20H47N3O and a molecular weight of 345.62 g/mol. Its IUPAC name is ethane;N'-ethyl-N-methylpropane-1,3-diamine;9-(propan-2-ylamino)nonanal.
| Compound Name | ethane;N'-ethyl-N-methylpropane-1,3-diamine;9-(propan-2-ylamino)nonanal |
|---|---|
| PubChem CID | 168958962 |
| Molecular Formula | C20H47N3O |
| Molecular Weight | 345.62 g/mol |
| Exact Mass | 345.37 |
| IUPAC Name | ethane;N'-ethyl-N-methylpropane-1,3-diamine;9-(propan-2-ylamino)nonanal |
| SMILES | CC.CC(C)NCCCCCCCCC=O.CCNCCCNC |
| InChI | InChI=1S/C12H25NO.C6H16N2.C2H6/c1-12(2)13-10-8-6-4-3-5-7-9-11-14;1-3-8-6-4-5-7-2;1-2/h11-13H,3-10H2,1-2H3;7-8H,3-6H2,1-2H3;1-2H3 |
| InChIKey | JSURTHNEBKPUKO-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.62 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|