C20H41NO3 — CID 168959279
ethane;3-hept-4-yn-2-yloxy-N,2,2-trimethyl-N-(2-methylpropyl)propanamide;methanol (PubChem CID 168959279) has the molecular formula C20H41NO3 and a molecular weight of 343.55 g/mol. Its IUPAC name is ethane;3-hept-4-yn-2-yloxy-N,2,2-trimethyl-N-(2-methylpropyl)propanamide;methanol.
| Compound Name | ethane;3-hept-4-yn-2-yloxy-N,2,2-trimethyl-N-(2-methylpropyl)propanamide;methanol |
|---|---|
| PubChem CID | 168959279 |
| Molecular Formula | C20H41NO3 |
| Molecular Weight | 343.55 g/mol |
| Exact Mass | 343.31 |
| IUPAC Name | ethane;3-hept-4-yn-2-yloxy-N,2,2-trimethyl-N-(2-methylpropyl)propanamide;methanol |
| SMILES | CC.CCC#CCC(C)OCC(C)(C)C(=O)N(C)CC(C)C.CO |
| InChI | InChI=1S/C17H31NO2.C2H6.CH4O/c1-8-9-10-11-15(4)20-13-17(5,6)16(19)18(7)12-14(2)3;2*1-2/h14-15H,8,11-13H2,1-7H3;1-2H3;2H,1H3 |
| InChIKey | HSYIDUREUYLYSS-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.55 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|