C32H31FN4O — CID 168960953
2-(3-azabicyclo[3.1.0]hexane-3-carbonyl)benzonitrile;1-(4-fluorophenyl)-6-methylindazole;(3Z)-penta-1,3-diene (PubChem CID 168960953) has the molecular formula C32H31FN4O and a molecular weight of 506.63 g/mol. Its IUPAC name is 2-(3-azabicyclo[3.1.0]hexane-3-carbonyl)benzonitrile;1-(4-fluorophenyl)-6-methylindazole;(3Z)-penta-1,3-diene.
| Compound Name | 2-(3-azabicyclo[3.1.0]hexane-3-carbonyl)benzonitrile;1-(4-fluorophenyl)-6-methylindazole;(3Z)-penta-1,3-diene |
|---|---|
| PubChem CID | 168960953 |
| Molecular Formula | C32H31FN4O |
| Molecular Weight | 506.63 g/mol |
| Exact Mass | 506.25 |
| IUPAC Name | 2-(3-azabicyclo[3.1.0]hexane-3-carbonyl)benzonitrile;1-(4-fluorophenyl)-6-methylindazole;(3Z)-penta-1,3-diene |
| SMILES | C=C/C=C\C.Cc1ccc2cnn(-c3ccc(F)cc3)c2c1.N#Cc1ccccc1C(=O)N1CC2CC2C1 |
| InChI | InChI=1S/C14H11FN2.C13H12N2O.C5H8/c1-10-2-3-11-9-16-17(14(11)8-10)13-6-4-12(15)5-7-13;14-6-9-3-1-2-4-12(9)13(16)15-7-10-5-11(10)8-15;1-3-5-4-2/h2-9H,1H3;1-4,10-11H,5,7-8H2;3-5H,1H2,2H3/b;;5-4- |
| InChIKey | QHCXZWBTEQJOQN-GDUSTKMHSA-N |
| XLogP | 6.87 |
| TPSA | 61.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.63 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|