C29H28FN3O3 — CID 168960997
2-methoxyethyl (1R,5S,6R)-1-[1-(4-fluorophenyl)-6-methylindazol-5-yl]-6-phenyl-3-azabicyclo[3.1.0]hexane-3-carboxylate (PubChem CID 168960997) has the molecular formula C29H28FN3O3 and a molecular weight of 485.56 g/mol. Its IUPAC name is 2-methoxyethyl (1R,5S,6R)-1-[1-(4-fluorophenyl)-6-methylindazol-5-yl]-6-phenyl-3-azabicyclo[3.1.0]hexane-3-carboxylate.
| Compound Name | 2-methoxyethyl (1R,5S,6R)-1-[1-(4-fluorophenyl)-6-methylindazol-5-yl]-6-phenyl-3-azabicyclo[3.1.0]hexane-3-carboxylate |
|---|---|
| PubChem CID | 168960997 |
| Molecular Formula | C29H28FN3O3 |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | 2-methoxyethyl (1R,5S,6R)-1-[1-(4-fluorophenyl)-6-methylindazol-5-yl]-6-phenyl-3-azabicyclo[3.1.0]hexane-3-carboxylate |
| SMILES | COCCOC(=O)N1C[C@H]2[C@H](c3ccccc3)[C@@]2(c2cc3cnn(-c4ccc(F)cc4)c3cc2C)C1 |
| InChI | InChI=1S/C29H28FN3O3/c1-19-14-26-21(16-31-33(26)23-10-8-22(30)9-11-23)15-24(19)29-18-32(28(34)36-13-12-35-2)17-25(29)27(29)20-6-4-3-5-7-20/h3-11,14-16,25,27H,12-13,17-18H2,1-2H3/t25-,27-,29+/m0/s1 |
| InChIKey | LSRHMXFJZDKEKL-MDZVADFISA-N |
| XLogP | 5.22 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|