C33H36FN3O3 — CID 168961019
tert-butyl 3a-[1-(4-fluorophenyl)-6-methylindazol-5-yl]-5-phenylmethoxy-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate (PubChem CID 168961019) has the molecular formula C33H36FN3O3 and a molecular weight of 541.67 g/mol. Its IUPAC name is tert-butyl 3a-[1-(4-fluorophenyl)-6-methylindazol-5-yl]-5-phenylmethoxy-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate.
| Compound Name | tert-butyl 3a-[1-(4-fluorophenyl)-6-methylindazol-5-yl]-5-phenylmethoxy-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168961019 |
| Molecular Formula | C33H36FN3O3 |
| Molecular Weight | 541.67 g/mol |
| Exact Mass | 541.27 |
| IUPAC Name | tert-butyl 3a-[1-(4-fluorophenyl)-6-methylindazol-5-yl]-5-phenylmethoxy-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate |
| SMILES | Cc1cc2c(cnn2-c2ccc(F)cc2)cc1C12CC(OCc3ccccc3)CC1CN(C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C33H36FN3O3/c1-22-14-30-24(18-35-37(30)27-12-10-26(34)11-13-27)15-29(22)33-17-28(39-20-23-8-6-5-7-9-23)16-25(33)19-36(21-33)31(38)40-32(2,3)4/h5-15,18,25,28H,16-17,19-21H2,1-4H3 |
| InChIKey | UVMMUFUROQDBLN-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.67 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |