C18H20Cl2N2OS — CID 16896234
3,4-dichloro-N-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]benzamide (PubChem CID 16896234) has the molecular formula C18H20Cl2N2OS and a molecular weight of 383.34 g/mol. Its IUPAC name is 3,4-dichloro-N-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]benzamide.
| Compound Name | 3,4-dichloro-N-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]benzamide |
|---|---|
| PubChem CID | 16896234 |
| Molecular Formula | C18H20Cl2N2OS |
| Molecular Weight | 383.34 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | 3,4-dichloro-N-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]benzamide |
| SMILES | O=C(NCC1CCN(Cc2cccs2)CC1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H20Cl2N2OS/c19-16-4-3-14(10-17(16)20)18(23)21-11-13-5-7-22(8-6-13)12-15-2-1-9-24-15/h1-4,9-10,13H,5-8,11-12H2,(H,21,23) |
| InChIKey | BWDDFXFZELLMKT-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.34 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |