C12H17FN2O — CID 168962653
(Z)-1-(6-fluoro-2,5-dimethyl-3-pyridinyl)-N-[(2-methylpropan-2-yl)oxy]methanimine (PubChem CID 168962653) has the molecular formula C12H17FN2O and a molecular weight of 224.28 g/mol. Its IUPAC name is (Z)-1-(6-fluoro-2,5-dimethyl-3-pyridinyl)-N-[(2-methylpropan-2-yl)oxy]methanimine.
| Compound Name | (Z)-1-(6-fluoro-2,5-dimethyl-3-pyridinyl)-N-[(2-methylpropan-2-yl)oxy]methanimine |
|---|---|
| PubChem CID | 168962653 |
| Molecular Formula | C12H17FN2O |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | (Z)-1-(6-fluoro-2,5-dimethyl-3-pyridinyl)-N-[(2-methylpropan-2-yl)oxy]methanimine |
| SMILES | Cc1cc(/C=N\OC(C)(C)C)c(C)nc1F |
| InChI | InChI=1S/C12H17FN2O/c1-8-6-10(9(2)15-11(8)13)7-14-16-12(3,4)5/h6-7H,1-5H3/b14-7- |
| InChIKey | QUPOCIVMYJBSFW-AUWJEWJLSA-N |
| XLogP | 2.99 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|