C29H33N5O6 — CID 168962695
8-[[4-[(Z)-C-(2,2-dihydroxy-1,3-benzodioxol-4-yl)-N-[(2-methylpropan-2-yl)oxy]carbonimidoyl]cyclohexyl]-methylamino]-5-methyl-6-oxo-1,5-naphthyridine-2-carbonitrile (PubChem CID 168962695) has the molecular formula C29H33N5O6 and a molecular weight of 547.61 g/mol. Its IUPAC name is 8-[[4-[(Z)-C-(2,2-dihydroxy-1,3-benzodioxol-4-yl)-N-[(2-methylpropan-2-yl)oxy]carbonimidoyl]cyclohexyl]-methylamino]-5-methyl-6-oxo-1,5-naphthyridine-2-carbonitrile.
| Compound Name | 8-[[4-[(Z)-C-(2,2-dihydroxy-1,3-benzodioxol-4-yl)-N-[(2-methylpropan-2-yl)oxy]carbonimidoyl]cyclohexyl]-methylamino]-5-methyl-6-oxo-1,5-naphthyridine-2-carbonitrile |
|---|---|
| PubChem CID | 168962695 |
| Molecular Formula | C29H33N5O6 |
| Molecular Weight | 547.61 g/mol |
| Exact Mass | 547.24 |
| IUPAC Name | 8-[[4-[(Z)-C-(2,2-dihydroxy-1,3-benzodioxol-4-yl)-N-[(2-methylpropan-2-yl)oxy]carbonimidoyl]cyclohexyl]-methylamino]-5-methyl-6-oxo-1,5-naphthyridine-2-carbonitrile |
| SMILES | CN(c1cc(=O)n(C)c2ccc(C#N)nc12)C1CCC(/C(=N/OC(C)(C)C)c2cccc3c2OC(O)(O)O3)CC1 |
| InChI | InChI=1S/C29H33N5O6/c1-28(2,3)40-32-25(20-7-6-8-23-27(20)39-29(36,37)38-23)17-9-12-19(13-10-17)33(4)22-15-24(35)34(5)21-14-11-18(16-30)31-26(21)22/h6-8,11,14-15,17,19,36-37H,9-10,12-13H2,1-5H3/b32-25- |
| InChIKey | CUYJWUHPGLWRDG-MKCFTUBBSA-N |
| XLogP | 3.39 |
| TPSA | 142.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.61 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|