C29H34ClN5O3 — CID 168962665
6-chloro-4-[[4-[(Z)-C-(2-methoxyphenyl)-N-[(2-methylpropan-2-yl)oxy]carbonimidoyl]cyclohexyl]-methylamino]-1-methyl-2-oxo-1,5-naphthyridine-3-carbonitrile (PubChem CID 168962665) has the molecular formula C29H34ClN5O3 and a molecular weight of 536.08 g/mol. Its IUPAC name is 6-chloro-4-[[4-[(Z)-C-(2-methoxyphenyl)-N-[(2-methylpropan-2-yl)oxy]carbonimidoyl]cyclohexyl]-methylamino]-1-methyl-2-oxo-1,5-naphthyridine-3-carbonitrile.
| Compound Name | 6-chloro-4-[[4-[(Z)-C-(2-methoxyphenyl)-N-[(2-methylpropan-2-yl)oxy]carbonimidoyl]cyclohexyl]-methylamino]-1-methyl-2-oxo-1,5-naphthyridine-3-carbonitrile |
|---|---|
| PubChem CID | 168962665 |
| Molecular Formula | C29H34ClN5O3 |
| Molecular Weight | 536.08 g/mol |
| Exact Mass | 535.24 |
| IUPAC Name | 6-chloro-4-[[4-[(Z)-C-(2-methoxyphenyl)-N-[(2-methylpropan-2-yl)oxy]carbonimidoyl]cyclohexyl]-methylamino]-1-methyl-2-oxo-1,5-naphthyridine-3-carbonitrile |
| SMILES | COc1ccccc1/C(=N\OC(C)(C)C)C1CCC(N(C)c2c(C#N)c(=O)n(C)c3ccc(Cl)nc23)CC1 |
| InChI | InChI=1S/C29H34ClN5O3/c1-29(2,3)38-33-25(20-9-7-8-10-23(20)37-6)18-11-13-19(14-12-18)34(4)27-21(17-31)28(36)35(5)22-15-16-24(30)32-26(22)27/h7-10,15-16,18-19H,11-14H2,1-6H3/b33-25- |
| InChIKey | TVINGLXTXQAHOV-IVQJCJPDSA-N |
| XLogP | 5.68 |
| TPSA | 92.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.08 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|