C27H28ClN5O2 — CID 166903758
6-chloro-4-[[4-[(Z)-N-cyclopropyloxy-C-phenylcarbonimidoyl]cyclohexyl]-methylamino]-1-methyl-2-oxo-1,5-naphthyridine-3-carbonitrile (PubChem CID 166903758) has the molecular formula C27H28ClN5O2 and a molecular weight of 490.01 g/mol. Its IUPAC name is 6-chloro-4-[[4-[(Z)-N-cyclopropyloxy-C-phenylcarbonimidoyl]cyclohexyl]-methylamino]-1-methyl-2-oxo-1,5-naphthyridine-3-carbonitrile.
| Compound Name | 6-chloro-4-[[4-[(Z)-N-cyclopropyloxy-C-phenylcarbonimidoyl]cyclohexyl]-methylamino]-1-methyl-2-oxo-1,5-naphthyridine-3-carbonitrile |
|---|---|
| PubChem CID | 166903758 |
| Molecular Formula | C27H28ClN5O2 |
| Molecular Weight | 490.01 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | 6-chloro-4-[[4-[(Z)-N-cyclopropyloxy-C-phenylcarbonimidoyl]cyclohexyl]-methylamino]-1-methyl-2-oxo-1,5-naphthyridine-3-carbonitrile |
| SMILES | CN(c1c(C#N)c(=O)n(C)c2ccc(Cl)nc12)C1CCC(/C(=N/OC2CC2)c2ccccc2)CC1 |
| InChI | InChI=1S/C27H28ClN5O2/c1-32(26-21(16-29)27(34)33(2)22-14-15-23(28)30-25(22)26)19-10-8-18(9-11-19)24(31-35-20-12-13-20)17-6-4-3-5-7-17/h3-7,14-15,18-20H,8-13H2,1-2H3/b31-24+ |
| InChIKey | BCAWAQUAIPSILH-QFMPWRQOSA-N |
| XLogP | 5.04 |
| TPSA | 83.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.01 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|