C27H28F2N6O2 — CID 168962815
8-[cyclohexyl(methyl)amino]-5-methyl-6-oxo-1,5-naphthyridine-2,7-dicarbonitrile;(Z)-N-(difluoromethoxy)-1-(2-methylphenyl)methanimine (PubChem CID 168962815) has the molecular formula C27H28F2N6O2 and a molecular weight of 506.56 g/mol. Its IUPAC name is 8-[cyclohexyl(methyl)amino]-5-methyl-6-oxo-1,5-naphthyridine-2,7-dicarbonitrile;(Z)-N-(difluoromethoxy)-1-(2-methylphenyl)methanimine.
| Compound Name | 8-[cyclohexyl(methyl)amino]-5-methyl-6-oxo-1,5-naphthyridine-2,7-dicarbonitrile;(Z)-N-(difluoromethoxy)-1-(2-methylphenyl)methanimine |
|---|---|
| PubChem CID | 168962815 |
| Molecular Formula | C27H28F2N6O2 |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | 8-[cyclohexyl(methyl)amino]-5-methyl-6-oxo-1,5-naphthyridine-2,7-dicarbonitrile;(Z)-N-(difluoromethoxy)-1-(2-methylphenyl)methanimine |
| SMILES | CN(c1c(C#N)c(=O)n(C)c2ccc(C#N)nc12)C1CCCCC1.Cc1ccccc1/C=N\OC(F)F |
| InChI | InChI=1S/C18H19N5O.C9H9F2NO/c1-22(13-6-4-3-5-7-13)17-14(11-20)18(24)23(2)15-9-8-12(10-19)21-16(15)17;1-7-4-2-3-5-8(7)6-12-13-9(10)11/h8-9,13H,3-7H2,1-2H3;2-6,9H,1H3/b;12-6- |
| InChIKey | QJKUIEHLVNRTHR-CNVRTYJXSA-N |
| XLogP | 5.01 |
| TPSA | 107.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|