C18H21BrN4O — CID 170792046
6-bromo-1-methyl-4-[methyl-(4-methylcyclohexyl)amino]-2-oxo-1,5-naphthyridine-3-carbonitrile (PubChem CID 170792046) has the molecular formula C18H21BrN4O and a molecular weight of 389.30 g/mol. Its IUPAC name is 6-bromo-1-methyl-4-[methyl-(4-methylcyclohexyl)amino]-2-oxo-1,5-naphthyridine-3-carbonitrile.
| Compound Name | 6-bromo-1-methyl-4-[methyl-(4-methylcyclohexyl)amino]-2-oxo-1,5-naphthyridine-3-carbonitrile |
|---|---|
| PubChem CID | 170792046 |
| Molecular Formula | C18H21BrN4O |
| Molecular Weight | 389.30 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | 6-bromo-1-methyl-4-[methyl-(4-methylcyclohexyl)amino]-2-oxo-1,5-naphthyridine-3-carbonitrile |
| SMILES | CC1CCC(N(C)c2c(C#N)c(=O)n(C)c3ccc(Br)nc23)CC1 |
| InChI | InChI=1S/C18H21BrN4O/c1-11-4-6-12(7-5-11)22(2)17-13(10-20)18(24)23(3)14-8-9-15(19)21-16(14)17/h8-9,11-12H,4-7H2,1-3H3 |
| InChIKey | KBJUHWWEDRHZIT-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 61.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.30 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|