C12H17BrClNO2 — CID 168962930
N-[1-(4-bromophenyl)-2-hydroxyethyl]-2-chloroacetamide;ethane (PubChem CID 168962930) has the molecular formula C12H17BrClNO2 and a molecular weight of 322.63 g/mol. Its IUPAC name is N-[1-(4-bromophenyl)-2-hydroxyethyl]-2-chloroacetamide;ethane.
| Compound Name | N-[1-(4-bromophenyl)-2-hydroxyethyl]-2-chloroacetamide;ethane |
|---|---|
| PubChem CID | 168962930 |
| Molecular Formula | C12H17BrClNO2 |
| Molecular Weight | 322.63 g/mol |
| Exact Mass | 321.01 |
| IUPAC Name | N-[1-(4-bromophenyl)-2-hydroxyethyl]-2-chloroacetamide;ethane |
| SMILES | CC.O=C(CCl)NC(CO)c1ccc(Br)cc1 |
| InChI | InChI=1S/C10H11BrClNO2.C2H6/c11-8-3-1-7(2-4-8)9(6-14)13-10(15)5-12;1-2/h1-4,9,14H,5-6H2,(H,13,15);1-2H3 |
| InChIKey | YETHKUTUDCUUOY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.63 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|