C10H11BrClNO2 — CID 164551444
N-[1-(2-bromophenyl)-2-hydroxyethyl]-2-chloroacetamide (PubChem CID 164551444) has the molecular formula C10H11BrClNO2 and a molecular weight of 292.56 g/mol. Its IUPAC name is N-[1-(2-bromophenyl)-2-hydroxyethyl]-2-chloroacetamide.
| Compound Name | N-[1-(2-bromophenyl)-2-hydroxyethyl]-2-chloroacetamide |
|---|---|
| PubChem CID | 164551444 |
| Molecular Formula | C10H11BrClNO2 |
| Molecular Weight | 292.56 g/mol |
| Exact Mass | 290.97 |
| IUPAC Name | N-[1-(2-bromophenyl)-2-hydroxyethyl]-2-chloroacetamide |
| SMILES | O=C(CCl)NC(CO)c1ccccc1Br |
| InChI | InChI=1S/C10H11BrClNO2/c11-8-4-2-1-3-7(8)9(6-14)13-10(15)5-12/h1-4,9,14H,5-6H2,(H,13,15) |
| InChIKey | USMBKGRPZMJMIQ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.56 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|