C9H12Cl2N2O2 — CID 168963015
4,5-dichloro-2-(1-methoxybutyl)pyridazin-3-one (PubChem CID 168963015) has the molecular formula C9H12Cl2N2O2 and a molecular weight of 251.11 g/mol. Its IUPAC name is 4,5-dichloro-2-(1-methoxybutyl)pyridazin-3-one.
| Compound Name | 4,5-dichloro-2-(1-methoxybutyl)pyridazin-3-one |
|---|---|
| PubChem CID | 168963015 |
| Molecular Formula | C9H12Cl2N2O2 |
| Molecular Weight | 251.11 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | 4,5-dichloro-2-(1-methoxybutyl)pyridazin-3-one |
| SMILES | CCCC(OC)n1ncc(Cl)c(Cl)c1=O |
| InChI | InChI=1S/C9H12Cl2N2O2/c1-3-4-7(15-2)13-9(14)8(11)6(10)5-12-13/h5,7H,3-4H2,1-2H3 |
| InChIKey | RPXJLHJZKGTBMA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.11 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |