C9H9Cl2F3N2O2 — CID 115590557
4,5-dichloro-2-[3-(2,2,2-trifluoroethoxy)propyl]pyridazin-3-one (PubChem CID 115590557) has the molecular formula C9H9Cl2F3N2O2 and a molecular weight of 305.08 g/mol. Its IUPAC name is 4,5-dichloro-2-[3-(2,2,2-trifluoroethoxy)propyl]pyridazin-3-one.
| Compound Name | 4,5-dichloro-2-[3-(2,2,2-trifluoroethoxy)propyl]pyridazin-3-one |
|---|---|
| PubChem CID | 115590557 |
| Molecular Formula | C9H9Cl2F3N2O2 |
| Molecular Weight | 305.08 g/mol |
| Exact Mass | 304.00 |
| IUPAC Name | 4,5-dichloro-2-[3-(2,2,2-trifluoroethoxy)propyl]pyridazin-3-one |
| SMILES | O=c1c(Cl)c(Cl)cnn1CCCOCC(F)(F)F |
| InChI | InChI=1S/C9H9Cl2F3N2O2/c10-6-4-15-16(8(17)7(6)11)2-1-3-18-5-9(12,13)14/h4H,1-3,5H2 |
| InChIKey | VPGOMWYIQPTVFP-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.08 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|