C7H5Cl2F3N2O2 — CID 114386423
4,5-dichloro-2-[2-(trifluoromethoxy)ethyl]pyridazin-3-one (PubChem CID 114386423) has the molecular formula C7H5Cl2F3N2O2 and a molecular weight of 277.03 g/mol. Its IUPAC name is 4,5-dichloro-2-[2-(trifluoromethoxy)ethyl]pyridazin-3-one.
| Compound Name | 4,5-dichloro-2-[2-(trifluoromethoxy)ethyl]pyridazin-3-one |
|---|---|
| PubChem CID | 114386423 |
| Molecular Formula | C7H5Cl2F3N2O2 |
| Molecular Weight | 277.03 g/mol |
| Exact Mass | 275.97 |
| IUPAC Name | 4,5-dichloro-2-[2-(trifluoromethoxy)ethyl]pyridazin-3-one |
| SMILES | O=c1c(Cl)c(Cl)cnn1CCOC(F)(F)F |
| InChI | InChI=1S/C7H5Cl2F3N2O2/c8-4-3-13-14(6(15)5(4)9)1-2-16-7(10,11)12/h3H,1-2H2 |
| InChIKey | ZRHHYQCAXNKAFY-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.03 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |