C25H27N5S — CID 168965296
4-benzyl-N-[2-(methylaminosulfanyl)ethyl]-2-[1-(pyridin-3-ylmethyl)pyrazol-3-yl]aniline (PubChem CID 168965296) has the molecular formula C25H27N5S and a molecular weight of 429.59 g/mol. Its IUPAC name is 4-benzyl-N-[2-(methylaminosulfanyl)ethyl]-2-[1-(pyridin-3-ylmethyl)pyrazol-3-yl]aniline.
| Compound Name | 4-benzyl-N-[2-(methylaminosulfanyl)ethyl]-2-[1-(pyridin-3-ylmethyl)pyrazol-3-yl]aniline |
|---|---|
| PubChem CID | 168965296 |
| Molecular Formula | C25H27N5S |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | 4-benzyl-N-[2-(methylaminosulfanyl)ethyl]-2-[1-(pyridin-3-ylmethyl)pyrazol-3-yl]aniline |
| SMILES | CNSCCNc1ccc(Cc2ccccc2)cc1-c1ccn(Cc2cccnc2)n1 |
| InChI | InChI=1S/C25H27N5S/c1-26-31-15-13-28-24-10-9-21(16-20-6-3-2-4-7-20)17-23(24)25-11-14-30(29-25)19-22-8-5-12-27-18-22/h2-12,14,17-18,26,28H,13,15-16,19H2,1H3 |
| InChIKey | KHPIYOOSLLBYBZ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 54.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|