C25H25N5O3S — CID 169043428
3-(methylsulfamoyl)-N-[4-phenyl-2-[1-(pyridin-3-ylmethyl)pyrazol-3-yl]phenyl]propanamide (PubChem CID 169043428) has the molecular formula C25H25N5O3S and a molecular weight of 475.57 g/mol. Its IUPAC name is 3-(methylsulfamoyl)-N-[4-phenyl-2-[1-(pyridin-3-ylmethyl)pyrazol-3-yl]phenyl]propanamide.
| Compound Name | 3-(methylsulfamoyl)-N-[4-phenyl-2-[1-(pyridin-3-ylmethyl)pyrazol-3-yl]phenyl]propanamide |
|---|---|
| PubChem CID | 169043428 |
| Molecular Formula | C25H25N5O3S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | 3-(methylsulfamoyl)-N-[4-phenyl-2-[1-(pyridin-3-ylmethyl)pyrazol-3-yl]phenyl]propanamide |
| SMILES | CNS(=O)(=O)CCC(=O)Nc1ccc(-c2ccccc2)cc1-c1ccn(Cc2cccnc2)n1 |
| InChI | InChI=1S/C25H25N5O3S/c1-26-34(32,33)15-12-25(31)28-23-10-9-21(20-7-3-2-4-8-20)16-22(23)24-11-14-30(29-24)18-19-6-5-13-27-17-19/h2-11,13-14,16-17,26H,12,15,18H2,1H3,(H,28,31) |
| InChIKey | VLDZWWCGCRHUJC-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |