C38H34FN5O2 — CID 168965324
tert-butyl N-[[6-(4-fluorophenyl)-4-(1-trityl-1,2,4-triazol-3-yl)-3-pyridinyl]methyl]carbamate (PubChem CID 168965324) has the molecular formula C38H34FN5O2 and a molecular weight of 611.72 g/mol. Its IUPAC name is tert-butyl N-[[6-(4-fluorophenyl)-4-(1-trityl-1,2,4-triazol-3-yl)-3-pyridinyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[6-(4-fluorophenyl)-4-(1-trityl-1,2,4-triazol-3-yl)-3-pyridinyl]methyl]carbamate |
|---|---|
| PubChem CID | 168965324 |
| Molecular Formula | C38H34FN5O2 |
| Molecular Weight | 611.72 g/mol |
| Exact Mass | 611.27 |
| IUPAC Name | tert-butyl N-[[6-(4-fluorophenyl)-4-(1-trityl-1,2,4-triazol-3-yl)-3-pyridinyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cnc(-c2ccc(F)cc2)cc1-c1ncn(C(c2ccccc2)(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C38H34FN5O2/c1-37(2,3)46-36(45)41-25-28-24-40-34(27-19-21-32(39)22-20-27)23-33(28)35-42-26-44(43-35)38(29-13-7-4-8-14-29,30-15-9-5-10-16-30)31-17-11-6-12-18-31/h4-24,26H,25H2,1-3H3,(H,41,45) |
| InChIKey | SXVUBHBKZNEAEV-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.72 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|