C22H27ClIN3O2S — CID 16896536
N-[2-(diethylamino)ethyl]-N-(6-ethoxy-1,3-benzothiazol-2-yl)-2-iodobenzamide;hydrochloride (PubChem CID 16896536) has the molecular formula C22H27ClIN3O2S and a molecular weight of 559.90 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-N-(6-ethoxy-1,3-benzothiazol-2-yl)-2-iodobenzamide;hydrochloride.
| Compound Name | N-[2-(diethylamino)ethyl]-N-(6-ethoxy-1,3-benzothiazol-2-yl)-2-iodobenzamide;hydrochloride |
|---|---|
| PubChem CID | 16896536 |
| Molecular Formula | C22H27ClIN3O2S |
| Molecular Weight | 559.90 g/mol |
| Exact Mass | 559.06 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-N-(6-ethoxy-1,3-benzothiazol-2-yl)-2-iodobenzamide;hydrochloride |
| SMILES | CCOc1ccc2nc(N(CCN(CC)CC)C(=O)c3ccccc3I)sc2c1.Cl |
| InChI | InChI=1S/C22H26IN3O2S.ClH/c1-4-25(5-2)13-14-26(21(27)17-9-7-8-10-18(17)23)22-24-19-12-11-16(28-6-3)15-20(19)29-22;/h7-12,15H,4-6,13-14H2,1-3H3;1H |
| InChIKey | KEJTYUUUUBNIRC-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.90 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|