C22H27ClN6O — CID 168967172
4-[2-(2,4-diamino-5-chloroquinazolin-6-yl)ethyl]-N-[4-(methylamino)butyl]benzamide (PubChem CID 168967172) has the molecular formula C22H27ClN6O and a molecular weight of 426.95 g/mol. Its IUPAC name is 4-[2-(2,4-diamino-5-chloroquinazolin-6-yl)ethyl]-N-[4-(methylamino)butyl]benzamide.
| Compound Name | 4-[2-(2,4-diamino-5-chloroquinazolin-6-yl)ethyl]-N-[4-(methylamino)butyl]benzamide |
|---|---|
| PubChem CID | 168967172 |
| Molecular Formula | C22H27ClN6O |
| Molecular Weight | 426.95 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 4-[2-(2,4-diamino-5-chloroquinazolin-6-yl)ethyl]-N-[4-(methylamino)butyl]benzamide |
| SMILES | CNCCCCNC(=O)c1ccc(CCc2ccc3nc(N)nc(N)c3c2Cl)cc1 |
| InChI | InChI=1S/C22H27ClN6O/c1-26-12-2-3-13-27-21(30)16-8-5-14(6-9-16)4-7-15-10-11-17-18(19(15)23)20(24)29-22(25)28-17/h5-6,8-11,26H,2-4,7,12-13H2,1H3,(H,27,30)(H4,24,25,28,29) |
| InChIKey | WTAOKPVMWGJDOU-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 118.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.95 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|