C17H12ClN5O2 — CID 168967741
5-[(2-chloro-4-pyridinyl)amino]-2-methylimidazo[1,2-c]quinazoline-8-carboxylic acid (PubChem CID 168967741) has the molecular formula C17H12ClN5O2 and a molecular weight of 353.77 g/mol. Its IUPAC name is 5-[(2-chloro-4-pyridinyl)amino]-2-methylimidazo[1,2-c]quinazoline-8-carboxylic acid.
| Compound Name | 5-[(2-chloro-4-pyridinyl)amino]-2-methylimidazo[1,2-c]quinazoline-8-carboxylic acid |
|---|---|
| PubChem CID | 168967741 |
| Molecular Formula | C17H12ClN5O2 |
| Molecular Weight | 353.77 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | 5-[(2-chloro-4-pyridinyl)amino]-2-methylimidazo[1,2-c]quinazoline-8-carboxylic acid |
| SMILES | Cc1cn2c(Nc3ccnc(Cl)c3)nc3cc(C(=O)O)ccc3c2n1 |
| InChI | InChI=1S/C17H12ClN5O2/c1-9-8-23-15(20-9)12-3-2-10(16(24)25)6-13(12)22-17(23)21-11-4-5-19-14(18)7-11/h2-8H,1H3,(H,24,25)(H,19,21,22) |
| InChIKey | AXQXJMBJBQPSEG-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 92.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.77 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|