C21H25N5O2 — CID 168970098
3-[4-(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)heptan-4-ylamino]benzoic acid (PubChem CID 168970098) has the molecular formula C21H25N5O2 and a molecular weight of 379.46 g/mol. Its IUPAC name is 3-[4-(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)heptan-4-ylamino]benzoic acid.
| Compound Name | 3-[4-(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)heptan-4-ylamino]benzoic acid |
|---|---|
| PubChem CID | 168970098 |
| Molecular Formula | C21H25N5O2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 3-[4-(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)heptan-4-ylamino]benzoic acid |
| SMILES | CCCC(CCC)(Nc1cccc(C(=O)O)c1)c1nc(-c2ccncc2)n[nH]1 |
| InChI | InChI=1S/C21H25N5O2/c1-3-10-21(11-4-2,24-17-7-5-6-16(14-17)19(27)28)20-23-18(25-26-20)15-8-12-22-13-9-15/h5-9,12-14,24H,3-4,10-11H2,1-2H3,(H,27,28)(H,23,25,26) |
| InChIKey | LWVYYTAIPIFPRJ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |