C40H55N7O6 — CID 168970204
N-[1-[3-[6-[2-[2-(3-oxopropoxy)ethoxy]ethoxy]hexoxy]phenyl]ethyl]-3-[[4-[N'-(pyridine-4-carboximidoyl)carbamimidoyl]piperidin-4-yl]amino]benzamide (PubChem CID 168970204) has the molecular formula C40H55N7O6 and a molecular weight of 729.92 g/mol. Its IUPAC name is N-[1-[3-[6-[2-[2-(3-oxopropoxy)ethoxy]ethoxy]hexoxy]phenyl]ethyl]-3-[[4-[N'-(pyridine-4-carboximidoyl)carbamimidoyl]piperidin-4-yl]amino]benzamide.
| Compound Name | N-[1-[3-[6-[2-[2-(3-oxopropoxy)ethoxy]ethoxy]hexoxy]phenyl]ethyl]-3-[[4-[N'-(pyridine-4-carboximidoyl)carbamimidoyl]piperidin-4-yl]amino]benzamide |
|---|---|
| PubChem CID | 168970204 |
| Molecular Formula | C40H55N7O6 |
| Molecular Weight | 729.92 g/mol |
| Exact Mass | 729.42 |
| IUPAC Name | N-[1-[3-[6-[2-[2-(3-oxopropoxy)ethoxy]ethoxy]hexoxy]phenyl]ethyl]-3-[[4-[N'-(pyridine-4-carboximidoyl)carbamimidoyl]piperidin-4-yl]amino]benzamide |
| SMILES | [H]/N=C(/N=C(\N)C1(Nc2cccc(C(=O)NC(C)c3cccc(OCCCCCCOCCOCCOCCC=O)c3)c2)CCNCC1)c1ccncc1 |
| InChI | InChI=1S/C40H55N7O6/c1-31(33-9-7-12-36(30-33)53-24-5-3-2-4-22-50-25-27-52-28-26-51-23-8-21-48)45-38(49)34-10-6-11-35(29-34)47-40(15-19-44-20-16-40)39(42)46-37(41)32-13-17-43-18-14-32/h6-7,9-14,17-18,21,29-31,44,47H,2-5,8,15-16,19-20,22-28H2,1H3,(H,45,49)(H3,41,42,46) |
| InChIKey | CCLYKVKEURGYQR-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 182.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.92 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|