C38H53N7O7 — CID 167193013
methyl 4-[2-[2-[6-[3-[(1S)-1-[[3-[[2-imino-2-[methyl(pyrimidine-4-carboximidoyl)amino]ethyl]amino]benzoyl]amino]ethyl]phenoxy]hexoxy]ethoxy]ethoxy]butanoate (PubChem CID 167193013) has the molecular formula C38H53N7O7 and a molecular weight of 719.88 g/mol. Its IUPAC name is methyl 4-[2-[2-[6-[3-[(1S)-1-[[3-[[2-imino-2-[methyl(pyrimidine-4-carboximidoyl)amino]ethyl]amino]benzoyl]amino]ethyl]phenoxy]hexoxy]ethoxy]ethoxy]butanoate.
| Compound Name | methyl 4-[2-[2-[6-[3-[(1S)-1-[[3-[[2-imino-2-[methyl(pyrimidine-4-carboximidoyl)amino]ethyl]amino]benzoyl]amino]ethyl]phenoxy]hexoxy]ethoxy]ethoxy]butanoate |
|---|---|
| PubChem CID | 167193013 |
| Molecular Formula | C38H53N7O7 |
| Molecular Weight | 719.88 g/mol |
| Exact Mass | 719.40 |
| IUPAC Name | methyl 4-[2-[2-[6-[3-[(1S)-1-[[3-[[2-imino-2-[methyl(pyrimidine-4-carboximidoyl)amino]ethyl]amino]benzoyl]amino]ethyl]phenoxy]hexoxy]ethoxy]ethoxy]butanoate |
| SMILES | [H]/N=C(/CNc1cccc(C(=O)N[C@@H](C)c2cccc(OCCCCCCOCCOCCOCCCC(=O)OC)c2)c1)N(C)/C(=N/[H])c1ccncn1 |
| InChI | InChI=1S/C38H53N7O7/c1-29(44-38(47)31-12-8-13-32(25-31)42-27-35(39)45(2)37(40)34-16-17-41-28-43-34)30-11-9-14-33(26-30)52-20-7-5-4-6-18-49-21-23-51-24-22-50-19-10-15-36(46)48-3/h8-9,11-14,16-17,25-26,28-29,39-40,42H,4-7,10,15,18-24,27H2,1-3H3,(H,44,47)/b39-35-,40-37+/t29-/m0/s1 |
| InChIKey | UNTLHZVILZLGKZ-LCVQVFDSSA-N |
| XLogP | 5.26 |
| TPSA | 181.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.88 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|