C39H54FN7O7 — CID 167192373
6-[2-[2-[6-[4-fluoro-3-[(1S)-1-[[3-[[2-imino-2-[methyl(pyrimidine-4-carboximidoyl)amino]ethyl]amino]benzoyl]amino]ethyl]phenoxy]hexoxy]ethoxy]ethoxy]hexanoic acid (PubChem CID 167192373) has the molecular formula C39H54FN7O7 and a molecular weight of 751.90 g/mol. Its IUPAC name is 6-[2-[2-[6-[4-fluoro-3-[(1S)-1-[[3-[[2-imino-2-[methyl(pyrimidine-4-carboximidoyl)amino]ethyl]amino]benzoyl]amino]ethyl]phenoxy]hexoxy]ethoxy]ethoxy]hexanoic acid.
| Compound Name | 6-[2-[2-[6-[4-fluoro-3-[(1S)-1-[[3-[[2-imino-2-[methyl(pyrimidine-4-carboximidoyl)amino]ethyl]amino]benzoyl]amino]ethyl]phenoxy]hexoxy]ethoxy]ethoxy]hexanoic acid |
|---|---|
| PubChem CID | 167192373 |
| Molecular Formula | C39H54FN7O7 |
| Molecular Weight | 751.90 g/mol |
| Exact Mass | 751.41 |
| IUPAC Name | 6-[2-[2-[6-[4-fluoro-3-[(1S)-1-[[3-[[2-imino-2-[methyl(pyrimidine-4-carboximidoyl)amino]ethyl]amino]benzoyl]amino]ethyl]phenoxy]hexoxy]ethoxy]ethoxy]hexanoic acid |
| SMILES | [H]/N=C(/CNc1cccc(C(=O)N[C@@H](C)c2cc(OCCCCCCOCCOCCOCCCCCC(=O)O)ccc2F)c1)N(C)/C(=N/[H])c1ccncn1 |
| InChI | InChI=1S/C39H54FN7O7/c1-29(46-39(50)30-11-10-12-31(25-30)44-27-36(41)47(2)38(42)35-16-17-43-28-45-35)33-26-32(14-15-34(33)40)54-20-9-4-3-7-18-51-21-23-53-24-22-52-19-8-5-6-13-37(48)49/h10-12,14-17,25-26,28-29,41-42,44H,3-9,13,18-24,27H2,1-2H3,(H,46,50)(H,48,49)/b41-36-,42-38+/t29-/m0/s1 |
| InChIKey | JXSLZGSVGDJZSZ-SJZWQRDWSA-N |
| XLogP | 6.09 |
| TPSA | 192.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.90 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|