C28H41BN7O2 — CID 168970573
CID 168970573 (PubChem CID 168970573) has the molecular formula C28H41BN7O2 and a molecular weight of 518.50 g/mol.
| Compound Name | CID 168970573 |
|---|---|
| PubChem CID | 168970573 |
| Molecular Formula | C28H41BN7O2 |
| Molecular Weight | 518.50 g/mol |
| Exact Mass | 518.34 |
| IUPAC Name | — |
| SMILES | C=CC(=C)N(C)CC(=O)NCCc1cccc(Nc2nc(N(C)C(C)C)c(C=C)nc2C(N)=O)c1.C[B]C |
| InChI | InChI=1S/C26H35N7O2.C2H6B/c1-8-18(5)32(6)16-22(34)28-14-13-19-11-10-12-20(15-19)29-25-23(24(27)35)30-21(9-2)26(31-25)33(7)17(3)4;1-3-2/h8-12,15,17H,1-2,5,13-14,16H2,3-4,6-7H3,(H2,27,35)(H,28,34)(H,29,31);1-2H3 |
| InChIKey | NZDOPJLQMBHEOU-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.50 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|