C9H14F3N — CID 168972404
N-[(Z)-1,1,1-trifluorobut-2-en-2-yl]pentan-2-imine (PubChem CID 168972404) has the molecular formula C9H14F3N and a molecular weight of 193.21 g/mol. Its IUPAC name is N-[(Z)-1,1,1-trifluorobut-2-en-2-yl]pentan-2-imine.
| Compound Name | N-[(Z)-1,1,1-trifluorobut-2-en-2-yl]pentan-2-imine |
|---|---|
| PubChem CID | 168972404 |
| Molecular Formula | C9H14F3N |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | N-[(Z)-1,1,1-trifluorobut-2-en-2-yl]pentan-2-imine |
| SMILES | C/C=C(\N=C(/C)CCC)C(F)(F)F |
| InChI | InChI=1S/C9H14F3N/c1-4-6-7(3)13-8(5-2)9(10,11)12/h5H,4,6H2,1-3H3/b8-5-,13-7+ |
| InChIKey | LFENGXWKVSBKRT-AXBOXZAGSA-N |
| XLogP | 3.71 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|