C22H14F3N3O3S — CID 168973870
(2R,6S)-4-[6-[[6-(trifluoromethyl)-2-pyridinyl]oxy]-1,3-benzothiazol-2-yl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 168973870) has the molecular formula C22H14F3N3O3S and a molecular weight of 457.43 g/mol. Its IUPAC name is (2R,6S)-4-[6-[[6-(trifluoromethyl)-2-pyridinyl]oxy]-1,3-benzothiazol-2-yl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (2R,6S)-4-[6-[[6-(trifluoromethyl)-2-pyridinyl]oxy]-1,3-benzothiazol-2-yl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 168973870 |
| Molecular Formula | C22H14F3N3O3S |
| Molecular Weight | 457.43 g/mol |
| Exact Mass | 457.07 |
| IUPAC Name | (2R,6S)-4-[6-[[6-(trifluoromethyl)-2-pyridinyl]oxy]-1,3-benzothiazol-2-yl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C1[C@@H]2C3C=CC(C3)[C@@H]2C(=O)N1c1nc2ccc(Oc3cccc(C(F)(F)F)n3)cc2s1 |
| InChI | InChI=1S/C22H14F3N3O3S/c23-22(24,25)15-2-1-3-16(27-15)31-12-6-7-13-14(9-12)32-21(26-13)28-19(29)17-10-4-5-11(8-10)18(17)20(28)30/h1-7,9-11,17-18H,8H2/t10?,11?,17-,18+ |
| InChIKey | AYZPRUWDMLOIIJ-SOMBMTDKSA-N |
| XLogP | 4.81 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.43 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|