C20H26N2O2 — CID 168974029
1-[(2,5-dimethylphenyl)methyl]-3-[4-(4-hydroxyphenyl)butan-2-yl]urea (PubChem CID 168974029) has the molecular formula C20H26N2O2 and a molecular weight of 326.44 g/mol. Its IUPAC name is 1-[(2,5-dimethylphenyl)methyl]-3-[4-(4-hydroxyphenyl)butan-2-yl]urea.
| Compound Name | 1-[(2,5-dimethylphenyl)methyl]-3-[4-(4-hydroxyphenyl)butan-2-yl]urea |
|---|---|
| PubChem CID | 168974029 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | 1-[(2,5-dimethylphenyl)methyl]-3-[4-(4-hydroxyphenyl)butan-2-yl]urea |
| SMILES | Cc1ccc(C)c(CNC(=O)NC(C)CCc2ccc(O)cc2)c1 |
| InChI | InChI=1S/C20H26N2O2/c1-14-4-5-15(2)18(12-14)13-21-20(24)22-16(3)6-7-17-8-10-19(23)11-9-17/h4-5,8-12,16,23H,6-7,13H2,1-3H3,(H2,21,22,24) |
| InChIKey | CIVHUXFMWFWYOU-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |