C26H31N3O5 — CID 168974032
tert-butyl 6-[4-(4-acetyloxyphenyl)butan-2-ylcarbamoylamino]indole-1-carboxylate (PubChem CID 168974032) has the molecular formula C26H31N3O5 and a molecular weight of 465.55 g/mol. Its IUPAC name is tert-butyl 6-[4-(4-acetyloxyphenyl)butan-2-ylcarbamoylamino]indole-1-carboxylate.
| Compound Name | tert-butyl 6-[4-(4-acetyloxyphenyl)butan-2-ylcarbamoylamino]indole-1-carboxylate |
|---|---|
| PubChem CID | 168974032 |
| Molecular Formula | C26H31N3O5 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | tert-butyl 6-[4-(4-acetyloxyphenyl)butan-2-ylcarbamoylamino]indole-1-carboxylate |
| SMILES | CC(=O)Oc1ccc(CCC(C)NC(=O)Nc2ccc3ccn(C(=O)OC(C)(C)C)c3c2)cc1 |
| InChI | InChI=1S/C26H31N3O5/c1-17(6-7-19-8-12-22(13-9-19)33-18(2)30)27-24(31)28-21-11-10-20-14-15-29(23(20)16-21)25(32)34-26(3,4)5/h8-17H,6-7H2,1-5H3,(H2,27,28,31) |
| InChIKey | NXATVIUFTQSITP-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|