C21H24ClN3O3 — CID 168974058
[4-[3-(1H-indol-6-ylcarbamoylamino)butyl]phenyl] acetate;hydrochloride (PubChem CID 168974058) has the molecular formula C21H24ClN3O3 and a molecular weight of 401.89 g/mol. Its IUPAC name is [4-[3-(1H-indol-6-ylcarbamoylamino)butyl]phenyl] acetate;hydrochloride.
| Compound Name | [4-[3-(1H-indol-6-ylcarbamoylamino)butyl]phenyl] acetate;hydrochloride |
|---|---|
| PubChem CID | 168974058 |
| Molecular Formula | C21H24ClN3O3 |
| Molecular Weight | 401.89 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | [4-[3-(1H-indol-6-ylcarbamoylamino)butyl]phenyl] acetate;hydrochloride |
| SMILES | CC(=O)Oc1ccc(CCC(C)NC(=O)Nc2ccc3cc[nH]c3c2)cc1.Cl |
| InChI | InChI=1S/C21H23N3O3.ClH/c1-14(3-4-16-5-9-19(10-6-16)27-15(2)25)23-21(26)24-18-8-7-17-11-12-22-20(17)13-18;/h5-14,22H,3-4H2,1-2H3,(H2,23,24,26);1H |
| InChIKey | ODMCFUKVFVZISZ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.89 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|