C25H37F5N4O6 — CID 168976335
methyl N-[(2S)-1-[(2S,4R)-2-[[(3S)-1-(cyclopropylamino)-6,6-difluoro-1,2-dioxoheptan-3-yl]carbamoyl]-4-(trifluoromethyl)piperidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate (PubChem CID 168976335) has the molecular formula C25H37F5N4O6 and a molecular weight of 584.58 g/mol. Its IUPAC name is methyl N-[(2S)-1-[(2S,4R)-2-[[(3S)-1-(cyclopropylamino)-6,6-difluoro-1,2-dioxoheptan-3-yl]carbamoyl]-4-(trifluoromethyl)piperidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate.
| Compound Name | methyl N-[(2S)-1-[(2S,4R)-2-[[(3S)-1-(cyclopropylamino)-6,6-difluoro-1,2-dioxoheptan-3-yl]carbamoyl]-4-(trifluoromethyl)piperidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 168976335 |
| Molecular Formula | C25H37F5N4O6 |
| Molecular Weight | 584.58 g/mol |
| Exact Mass | 584.26 |
| IUPAC Name | methyl N-[(2S)-1-[(2S,4R)-2-[[(3S)-1-(cyclopropylamino)-6,6-difluoro-1,2-dioxoheptan-3-yl]carbamoyl]-4-(trifluoromethyl)piperidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
| SMILES | COC(=O)N[C@H](C(=O)N1CC[C@@H](C(F)(F)F)C[C@H]1C(=O)N[C@@H](CCC(C)(F)F)C(=O)C(=O)NC1CC1)C(C)(C)C |
| InChI | InChI=1S/C25H37F5N4O6/c1-23(2,3)18(33-22(39)40-5)21(38)34-11-9-13(25(28,29)30)12-16(34)19(36)32-15(8-10-24(4,26)27)17(35)20(37)31-14-6-7-14/h13-16,18H,6-12H2,1-5H3,(H,31,37)(H,32,36)(H,33,39)/t13-,15+,16+,18-/m1/s1 |
| InChIKey | MJZNRHTYZRSATJ-GRZALLJUSA-N |
| XLogP | 2.69 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.58 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|