About ethane;3-methoxy-1-methylpyrrolidine;propan-2-ol
ethane;3-methoxy-1-methylpyrrolidine;propan-2-ol (PubChem CID 168976522) has the molecular formula C11H27NO2
and a molecular weight of 205.34 g/mol. Its IUPAC name is ethane;3-methoxy-1-methylpyrrolidine;propan-2-ol.
Molecular Properties
| Compound Name | ethane;3-methoxy-1-methylpyrrolidine;propan-2-ol |
| PubChem CID | 168976522 |
| Molecular Formula | C11H27NO2 |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.20 |
| IUPAC Name | ethane;3-methoxy-1-methylpyrrolidine;propan-2-ol |
| SMILES | CC.CC(C)O.COC1CCN(C)C1 |
| InChI | InChI=1S/C6H13NO.C3H8O.C2H6/c1-7-4-3-6(5-7)8-2;1-3(2)4;1-2/h6H,3-5H2,1-2H3;3-4H,1-2H3;1-2H3 |
| InChIKey | HFRWPPKNAJKBEQ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;3-methoxy-1-methylpyrrolidine;propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methoxy-1-methylpyrrolidine;propan-2-ol?
The IUPAC name of ethane;3-methoxy-1-methylpyrrolidine;propan-2-ol (CID 168976522) is ethane;3-methoxy-1-methylpyrrolidine;propan-2-ol.
What is the SMILES notation for ethane;3-methoxy-1-methylpyrrolidine;propan-2-ol?
The canonical SMILES for ethane;3-methoxy-1-methylpyrrolidine;propan-2-ol is CC.CC(C)O.COC1CCN(C)C1.
What is the InChIKey of ethane;3-methoxy-1-methylpyrrolidine;propan-2-ol?
The InChIKey is HFRWPPKNAJKBEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO.C3H8O.C2H6/c1-7-4-3-6(5-7)8-2;1-3(2)4;1-2/h6H,3-5H2,1-2H3;3-4H,1-2H3;1-2H3.
What are the key properties of ethane;3-methoxy-1-methylpyrrolidine;propan-2-ol?
ethane;3-methoxy-1-methylpyrrolidine;propan-2-ol has a molecular weight of 205.34 g/mol, XLogP of 1.75, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methoxy-1-methylpyrrolidine;propan-2-ol is sourced from PubChem (CID 168976522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).