C14H12FN3S — CID 168979376
(2E)-2-ethylidene-5-(7-fluoro-2-methylindazol-5-yl)thiophen-3-imine (PubChem CID 168979376) has the molecular formula C14H12FN3S and a molecular weight of 273.34 g/mol. Its IUPAC name is (2E)-2-ethylidene-5-(7-fluoro-2-methylindazol-5-yl)thiophen-3-imine.
| Compound Name | (2E)-2-ethylidene-5-(7-fluoro-2-methylindazol-5-yl)thiophen-3-imine |
|---|---|
| PubChem CID | 168979376 |
| Molecular Formula | C14H12FN3S |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | (2E)-2-ethylidene-5-(7-fluoro-2-methylindazol-5-yl)thiophen-3-imine |
| SMILES | [H]/N=C1\C=C(c2cc(F)c3nn(C)cc3c2)S\C1=C\C |
| InChI | InChI=1S/C14H12FN3S/c1-3-12-11(16)6-13(19-12)8-4-9-7-18(2)17-14(9)10(15)5-8/h3-7,16H,1-2H3/b12-3+,16-11+ |
| InChIKey | KVIPMQSQILJBKK-VIPDRGTFSA-N |
| XLogP | 3.72 |
| TPSA | 41.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|