C14H21NO3 — CID 168979950
methyl (2E,5E)-2-(3-methyl-2-oxobutanimidoyl)octa-2,5-dienoate (PubChem CID 168979950) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is methyl (2E,5E)-2-(3-methyl-2-oxobutanimidoyl)octa-2,5-dienoate.
| Compound Name | methyl (2E,5E)-2-(3-methyl-2-oxobutanimidoyl)octa-2,5-dienoate |
|---|---|
| PubChem CID | 168979950 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | methyl (2E,5E)-2-(3-methyl-2-oxobutanimidoyl)octa-2,5-dienoate |
| SMILES | [H]/N=C(C(=O)C(C)C)/C(=C\C/C=C/CC)C(=O)OC |
| InChI | InChI=1S/C14H21NO3/c1-5-6-7-8-9-11(14(17)18-4)12(15)13(16)10(2)3/h6-7,9-10,15H,5,8H2,1-4H3/b7-6+,11-9+,15-12- |
| InChIKey | JVTMOSLDIOFOAK-QZVILDLXSA-N |
| XLogP | 2.69 |
| TPSA | 67.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|