C10H13NO2 — CID 123448541
methyl 7-imino-6-methylcyclohepta-1,3-diene-1-carboxylate (PubChem CID 123448541) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is methyl 7-imino-6-methylcyclohepta-1,3-diene-1-carboxylate.
| Compound Name | methyl 7-imino-6-methylcyclohepta-1,3-diene-1-carboxylate |
|---|---|
| PubChem CID | 123448541 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | methyl 7-imino-6-methylcyclohepta-1,3-diene-1-carboxylate |
| SMILES | [H]/N=C1/C(C(=O)OC)=CC=CCC1C |
| InChI | InChI=1S/C10H13NO2/c1-7-5-3-4-6-8(9(7)11)10(12)13-2/h3-4,6-7,11H,5H2,1-2H3/b11-9+ |
| InChIKey | FKUROPVXUUBNAF-PKNBQFBNSA-N |
| XLogP | 1.70 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|