C22H21N5O5 — CID 16898028
ethyl 2-[[2-(3,4-dioxo-8-phenyl-6,7-dihydroimidazo[2,1-c][1,2,4]triazin-2-yl)acetyl]amino]benzoate (PubChem CID 16898028) has the molecular formula C22H21N5O5 and a molecular weight of 435.44 g/mol. Its IUPAC name is ethyl 2-[[2-(3,4-dioxo-8-phenyl-6,7-dihydroimidazo[2,1-c][1,2,4]triazin-2-yl)acetyl]amino]benzoate.
| Compound Name | ethyl 2-[[2-(3,4-dioxo-8-phenyl-6,7-dihydroimidazo[2,1-c][1,2,4]triazin-2-yl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 16898028 |
| Molecular Formula | C22H21N5O5 |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | ethyl 2-[[2-(3,4-dioxo-8-phenyl-6,7-dihydroimidazo[2,1-c][1,2,4]triazin-2-yl)acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)Cn1nc2n(c(=O)c1=O)CCN2c1ccccc1 |
| InChI | InChI=1S/C22H21N5O5/c1-2-32-21(31)16-10-6-7-11-17(16)23-18(28)14-27-20(30)19(29)26-13-12-25(22(26)24-27)15-8-4-3-5-9-15/h3-11H,2,12-14H2,1H3,(H,23,28) |
| InChIKey | CKIAXYMRBDHBLG-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 115.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|